C14H17BrN2O2 — CID 110147243
(4aS,8aS)-6-[(2-bromophenyl)methyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 110147243) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is (4aS,8aS)-6-[(2-bromophenyl)methyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aS,8aS)-6-[(2-bromophenyl)methyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 110147243 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (4aS,8aS)-6-[(2-bromophenyl)methyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCN(Cc3ccccc3Br)C[C@@H]2N1 |
| InChI | InChI=1S/C14H17BrN2O2/c15-11-4-2-1-3-10(11)7-17-6-5-13-12(8-17)16-14(18)9-19-13/h1-4,12-13H,5-9H2,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | MITSBVRCLGMJBA-STQMWFEESA-N |
| XLogP | 1.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |