C19H26O5 — CID 110147318
(2R,3R,4aR,10bR)-9-methoxy-5,5-dimethyl-2-propyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-3-carboxylic acid (PubChem CID 110147318) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2R,3R,4aR,10bR)-9-methoxy-5,5-dimethyl-2-propyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-3-carboxylic acid.
| Compound Name | (2R,3R,4aR,10bR)-9-methoxy-5,5-dimethyl-2-propyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 110147318 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2R,3R,4aR,10bR)-9-methoxy-5,5-dimethyl-2-propyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromene-3-carboxylic acid |
| SMILES | CCC[C@H]1O[C@H]2c3cc(OC)ccc3OC(C)(C)[C@@H]2C[C@H]1C(=O)O |
| InChI | InChI=1S/C19H26O5/c1-5-6-15-13(18(20)21)10-14-17(23-15)12-9-11(22-4)7-8-16(12)24-19(14,2)3/h7-9,13-15,17H,5-6,10H2,1-4H3,(H,20,21)/t13-,14-,15-,17+/m1/s1 |
| InChIKey | KZABLKGKOVACAE-ANQUJSFKSA-N |
| XLogP | 3.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |