C25H36N2O5 — CID 110147830
N-[6-[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]-6-oxohexyl]acetamide (PubChem CID 110147830) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is N-[6-[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]-6-oxohexyl]acetamide.
| Compound Name | N-[6-[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]-6-oxohexyl]acetamide |
|---|---|
| PubChem CID | 110147830 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[6-[(1R,10R,12R,17R)-5-hydroxy-9,9-dimethyl-8,18-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-13-yl]-6-oxohexyl]acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1CCC[C@H]2O[C@H]3c4ccc(O)cc4OC(C)(C)[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C25H36N2O5/c1-16(28)26-12-6-4-5-9-23(30)27-13-7-8-21-20(27)15-19-24(31-21)18-11-10-17(29)14-22(18)32-25(19,2)3/h10-11,14,19-21,24,29H,4-9,12-13,15H2,1-3H3,(H,26,28)/t19-,20-,21-,24+/m1/s1 |
| InChIKey | NWHBJPBJWXZKMM-CTVDGRRTSA-N |
| XLogP | 3.70 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|