C28H33N3O4 — CID 110148090
4-[2-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 110148090) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[2-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 110148090 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 4-[2-[(1R,10R,12S,17R)-5,9,9-trimethyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5-trien-14-yl]acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | Cc1ccc2c(c1)OC(C)(C)[C@@H]1C[C@H]3CN(CC(=O)N4CC(=O)Nc5ccccc54)CC[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C28H33N3O4/c1-17-8-9-19-24(12-17)35-28(2,3)20-13-18-14-30(11-10-23(18)34-27(19)20)16-26(33)31-15-25(32)29-21-6-4-5-7-22(21)31/h4-9,12,18,20,23,27H,10-11,13-16H2,1-3H3,(H,29,32)/t18-,20+,23+,27-/m0/s1 |
| InChIKey | BKXIOMCQZZBIAE-VMMBVYDISA-N |
| XLogP | 3.92 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |