C23H37N3O4S — CID 110148151
2-[2-[[(4aR,9aR)-5-methylsulfonyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]methyl]-4-tert-butylphenoxy]acetamide (PubChem CID 110148151) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is 2-[2-[[(4aR,9aR)-5-methylsulfonyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]methyl]-4-tert-butylphenoxy]acetamide.
| Compound Name | 2-[2-[[(4aR,9aR)-5-methylsulfonyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]methyl]-4-tert-butylphenoxy]acetamide |
|---|---|
| PubChem CID | 110148151 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[2-[[(4aR,9aR)-5-methylsulfonyl-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-1-yl]methyl]-4-tert-butylphenoxy]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(N)=O)c(CN2CCC[C@@H]3[C@H]2CCCCN3S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H37N3O4S/c1-23(2,3)18-10-11-21(30-16-22(24)27)17(14-18)15-25-12-7-9-20-19(25)8-5-6-13-26(20)31(4,28)29/h10-11,14,19-20H,5-9,12-13,15-16H2,1-4H3,(H2,24,27)/t19-,20-/m1/s1 |
| InChIKey | REIQBVGQIMZYLU-WOJBJXKFSA-N |
| XLogP | 2.63 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |