C28H35N3O3 — CID 110148587
2-[(2S,3aS,8aS)-2-(4-methoxyphenyl)-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 110148587) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-[(2S,3aS,8aS)-2-(4-methoxyphenyl)-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[(2S,3aS,8aS)-2-(4-methoxyphenyl)-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 110148587 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2-[(2S,3aS,8aS)-2-(4-methoxyphenyl)-3a-methyl-5-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | COc1ccc([C@@H]2C[C@]3(C)NC(=O)CCC[C@@H]3N2CC(=O)Nc2cccc3c2CCCC3)cc1 |
| InChI | InChI=1S/C28H35N3O3/c1-28-17-24(20-13-15-21(34-2)16-14-20)31(25(28)11-6-12-26(32)30-28)18-27(33)29-23-10-5-8-19-7-3-4-9-22(19)23/h5,8,10,13-16,24-25H,3-4,6-7,9,11-12,17-18H2,1-2H3,(H,29,33)(H,30,32)/t24-,25-,28-/m0/s1 |
| InChIKey | OEDFIUFGCHEOHX-VBOOUTDYSA-N |
| XLogP | 4.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |