C26H33ClN2O2 — CID 110148737
(4S,4aS,5S,8aR)-5-(benzylamino)-4-(4-chlorophenyl)-1-(3-methoxypropyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one (PubChem CID 110148737) has the molecular formula C26H33ClN2O2 and a molecular weight of 441.02 g/mol. Its IUPAC name is (4S,4aS,5S,8aR)-5-(benzylamino)-4-(4-chlorophenyl)-1-(3-methoxypropyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one.
| Compound Name | (4S,4aS,5S,8aR)-5-(benzylamino)-4-(4-chlorophenyl)-1-(3-methoxypropyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
|---|---|
| PubChem CID | 110148737 |
| Molecular Formula | C26H33ClN2O2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (4S,4aS,5S,8aR)-5-(benzylamino)-4-(4-chlorophenyl)-1-(3-methoxypropyl)-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-one |
| SMILES | COCCCN1C(=O)C[C@H](c2ccc(Cl)cc2)[C@H]2[C@@H](NCc3ccccc3)CCC[C@H]21 |
| InChI | InChI=1S/C26H33ClN2O2/c1-31-16-6-15-29-24-10-5-9-23(28-18-19-7-3-2-4-8-19)26(24)22(17-25(29)30)20-11-13-21(27)14-12-20/h2-4,7-8,11-14,22-24,26,28H,5-6,9-10,15-18H2,1H3/t22-,23+,24-,26+/m1/s1 |
| InChIKey | ZOFWBPQWCPFYBD-TWZJLLKVSA-N |
| XLogP | 5.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|