C26H24N4O2 — CID 110149381
(3-pyrimidin-2-yloxyphenyl)-[3-(quinolin-5-ylmethyl)piperidin-1-yl]methanone (PubChem CID 110149381) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is (3-pyrimidin-2-yloxyphenyl)-[3-(quinolin-5-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (3-pyrimidin-2-yloxyphenyl)-[3-(quinolin-5-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110149381 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (3-pyrimidin-2-yloxyphenyl)-[3-(quinolin-5-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc(Oc2ncccn2)c1)N1CCCC(Cc2cccc3ncccc23)C1 |
| InChI | InChI=1S/C26H24N4O2/c31-25(21-8-1-9-22(17-21)32-26-28-13-5-14-29-26)30-15-4-6-19(18-30)16-20-7-2-11-24-23(20)10-3-12-27-24/h1-3,5,7-14,17,19H,4,6,15-16,18H2 |
| InChIKey | PRSMSDTZXCABQT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |