C10H12F12OSi — CID 11014955
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy(trimethyl)silane (PubChem CID 11014955) has the molecular formula C10H12F12OSi and a molecular weight of 404.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy(trimethyl)silane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy(trimethyl)silane |
|---|---|
| PubChem CID | 11014955 |
| Molecular Formula | C10H12F12OSi |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F12OSi/c1-24(2,3)23-4-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h5H,4H2,1-3H3 |
| InChIKey | GDEBFZYIUPIZAR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|