About [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate
[3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate (PubChem CID 11014962) has the molecular formula C24H24N2O4
and a molecular weight of 404.47 g/mol. Its IUPAC name is [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate.
Molecular Properties
| Compound Name | [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate |
| PubChem CID | 11014962 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate |
| SMILES | CN(C)C(=O)Oc1cccnc1COC(=O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-24(18-11-6-4-7-12-18,19-13-8-5-9-14-19)22(27)29-17-20-21(15-10-16-25-20)30-23(28)26(2)3/h4-16H,17H2,1-3H3 |
| InChIKey | HZBZOQXOPJJRLQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate?
The IUPAC name of [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate (CID 11014962) is [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate.
What is the SMILES notation for [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate?
The canonical SMILES for [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate is CN(C)C(=O)Oc1cccnc1COC(=O)C(C)(c1ccccc1)c1ccccc1.
What is the InChIKey of [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate?
The InChIKey is HZBZOQXOPJJRLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O4/c1-24(18-11-6-4-7-12-18,19-13-8-5-9-14-19)22(27)29-17-20-21(15-10-16-25-20)30-23(28)26(2)3/h4-16H,17H2,1-3H3.
What are the key properties of [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate?
[3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate has a molecular weight of 404.47 g/mol, XLogP of 4.19, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl 2,2-diphenylpropanoate is sourced from PubChem (CID 11014962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).