C23H32O6 — CID 11014966
methyl 2-[(1R,6R,9S,10R,15R)-15-methoxy-6,9,10-trimethyl-5-methylidene-13-oxo-14,17-dioxatetracyclo[8.7.0.01,6.012,16]heptadec-12(16)-en-15-yl]acetate (PubChem CID 11014966) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is methyl 2-[(1R,6R,9S,10R,15R)-15-methoxy-6,9,10-trimethyl-5-methylidene-13-oxo-14,17-dioxatetracyclo[8.7.0.01,6.012,16]heptadec-12(16)-en-15-yl]acetate.
| Compound Name | methyl 2-[(1R,6R,9S,10R,15R)-15-methoxy-6,9,10-trimethyl-5-methylidene-13-oxo-14,17-dioxatetracyclo[8.7.0.01,6.012,16]heptadec-12(16)-en-15-yl]acetate |
|---|---|
| PubChem CID | 11014966 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl 2-[(1R,6R,9S,10R,15R)-15-methoxy-6,9,10-trimethyl-5-methylidene-13-oxo-14,17-dioxatetracyclo[8.7.0.01,6.012,16]heptadec-12(16)-en-15-yl]acetate |
| SMILES | C=C1CCC[C@@]23OC4=C(C[C@]2(C)[C@@H](C)CC[C@]13C)C(=O)O[C@@]4(CC(=O)OC)OC |
| InChI | InChI=1S/C23H32O6/c1-14-8-7-10-23-20(14,3)11-9-15(2)21(23,4)12-16-18(28-23)22(27-6,29-19(16)25)13-17(24)26-5/h15H,1,7-13H2,2-6H3/t15-,20+,21+,22+,23-/m0/s1 |
| InChIKey | IFHCIGWAGHBGMM-MJVSKNTISA-N |
| XLogP | 4.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|