C30H33N3O2 — CID 110149897
N-[(1S,3aS,7aR)-5-(2,2-diphenylacetyl)-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide (PubChem CID 110149897) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[(1S,3aS,7aR)-5-(2,2-diphenylacetyl)-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide.
| Compound Name | N-[(1S,3aS,7aR)-5-(2,2-diphenylacetyl)-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide |
|---|---|
| PubChem CID | 110149897 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-[(1S,3aS,7aR)-5-(2,2-diphenylacetyl)-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-3a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CN(C(=O)C(c3ccccc3)c3ccccc3)CC[C@@H]1[C@@H](c1ccccc1)N(C)C2 |
| InChI | InChI=1S/C30H33N3O2/c1-22(34)31-30-20-32(2)28(25-16-10-5-11-17-25)26(30)18-19-33(21-30)29(35)27(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-17,26-28H,18-21H2,1-2H3,(H,31,34)/t26-,28-,30+/m1/s1 |
| InChIKey | DZRNVAOFFRYBQW-GFKSZRKTSA-N |
| XLogP | 4.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |