C24H29N2O2P — CID 11015051
1-[(2S,4S)-4-diphenylphosphanyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 11015051) has the molecular formula C24H29N2O2P and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-[(2S,4S)-4-diphenylphosphanyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S,4S)-4-diphenylphosphanyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11015051 |
| Molecular Formula | C24H29N2O2P |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[(2S,4S)-4-diphenylphosphanyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](P(c2ccccc2)c2ccccc2)C[C@H]1C1=N[C@@H](C(C)C)CO1 |
| InChI | InChI=1S/C24H29N2O2P/c1-17(2)22-16-28-24(25-22)23-14-21(15-26(23)18(3)27)29(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,17,21-23H,14-16H2,1-3H3/t21-,22+,23-/m0/s1 |
| InChIKey | RQYMSILFWUEFLF-ZRBLBEILSA-N |
| XLogP | 3.56 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|