C19H15N5O6 — CID 11015074
9,10-dimethoxy-7-(3-nitrophenyl)-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione (PubChem CID 11015074) has the molecular formula C19H15N5O6 and a molecular weight of 409.36 g/mol. Its IUPAC name is 9,10-dimethoxy-7-(3-nitrophenyl)-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione.
| Compound Name | 9,10-dimethoxy-7-(3-nitrophenyl)-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione |
|---|---|
| PubChem CID | 11015074 |
| Molecular Formula | C19H15N5O6 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 9,10-dimethoxy-7-(3-nitrophenyl)-2,12-dihydro-[1,2,4]triazino[4,3-c][2,3]benzodiazepine-3,4-dione |
| SMILES | COc1cc2c(cc1OC)C(c1cccc([N+](=O)[O-])c1)=Nn1c(n[nH]c(=O)c1=O)C2 |
| InChI | InChI=1S/C19H15N5O6/c1-29-14-7-11-8-16-20-21-18(25)19(26)23(16)22-17(13(11)9-15(14)30-2)10-4-3-5-12(6-10)24(27)28/h3-7,9H,8H2,1-2H3,(H,21,25) |
| InChIKey | XDVLROQSALXXMS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|