C16H31IO2Si — CID 11015096
(2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dien-1-ol (PubChem CID 11015096) has the molecular formula C16H31IO2Si and a molecular weight of 410.41 g/mol. Its IUPAC name is (2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dien-1-ol.
| Compound Name | (2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 11015096 |
| Molecular Formula | C16H31IO2Si |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (2R,3R,4E,6E)-2-[tert-butyl(dimethyl)silyl]oxy-7-iodo-3,5,6-trimethylhepta-4,6-dien-1-ol |
| SMILES | CC(=C\I)/C(C)=C/[C@@H](C)[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H31IO2Si/c1-12(14(3)10-17)9-13(2)15(11-18)19-20(7,8)16(4,5)6/h9-10,13,15,18H,11H2,1-8H3/b12-9+,14-10+/t13-,15+/m1/s1 |
| InChIKey | ZGDBKESTQPPUMM-SKXMOWTRSA-N |
| XLogP | 5.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|