C28H38N4O2 — CID 110152316
N-[(1S,3aR,7aR)-2-[[4-hydroxy-1-(4-methylphenyl)piperidin-4-yl]methyl]-1-phenyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]acetamide (PubChem CID 110152316) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-[(1S,3aR,7aR)-2-[[4-hydroxy-1-(4-methylphenyl)piperidin-4-yl]methyl]-1-phenyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]acetamide.
| Compound Name | N-[(1S,3aR,7aR)-2-[[4-hydroxy-1-(4-methylphenyl)piperidin-4-yl]methyl]-1-phenyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]acetamide |
|---|---|
| PubChem CID | 110152316 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | N-[(1S,3aR,7aR)-2-[[4-hydroxy-1-(4-methylphenyl)piperidin-4-yl]methyl]-1-phenyl-3,4,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-3a-yl]acetamide |
| SMILES | CC(=O)N[C@@]12CNCC[C@@H]1[C@@H](c1ccccc1)N(CC1(O)CCN(c3ccc(C)cc3)CC1)C2 |
| InChI | InChI=1S/C28H38N4O2/c1-21-8-10-24(11-9-21)31-16-13-27(34,14-17-31)19-32-20-28(30-22(2)33)18-29-15-12-25(28)26(32)23-6-4-3-5-7-23/h3-11,25-26,29,34H,12-20H2,1-2H3,(H,30,33)/t25-,26-,28-/m1/s1 |
| InChIKey | YYPUZAZUUIDXSJ-STROYTFGSA-N |
| XLogP | 2.87 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|