About 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide
2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide (PubChem CID 1101526) has the molecular formula C23H30N2O5S2
and a molecular weight of 478.64 g/mol. Its IUPAC name is 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide.
Molecular Properties
| Compound Name | 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide |
| PubChem CID | 1101526 |
| Molecular Formula | C23H30N2O5S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide |
| SMILES | CC(C)CCNS(=O)(=O)c1ccc2c(c1)C(=O)c1cc(S(=O)(=O)NCCC(C)C)ccc1-2 |
| InChI | InChI=1S/C23H30N2O5S2/c1-15(2)9-11-24-31(27,28)17-5-7-19-20-8-6-18(14-22(20)23(26)21(19)13-17)32(29,30)25-12-10-16(3)4/h5-8,13-16,24-25H,9-12H2,1-4H3 |
| InChIKey | GDQGEKWLRCKEMY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide?
The IUPAC name of 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide (CID 1101526) is 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide.
What is the SMILES notation for 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide?
The canonical SMILES for 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide is CC(C)CCNS(=O)(=O)c1ccc2c(c1)C(=O)c1cc(S(=O)(=O)NCCC(C)C)ccc1-2.
What is the InChIKey of 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide?
The InChIKey is GDQGEKWLRCKEMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O5S2/c1-15(2)9-11-24-31(27,28)17-5-7-19-20-8-6-18(14-22(20)23(26)21(19)13-17)32(29,30)25-12-10-16(3)4/h5-8,13-16,24-25H,9-12H2,1-4H3.
What are the key properties of 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide?
2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide has a molecular weight of 478.64 g/mol, XLogP of 3.55, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,7-N-bis(3-methylbutyl)-9-oxofluorene-2,7-disulfonamide is sourced from PubChem (CID 1101526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).