C24H26N4O3 — CID 11015270
(10R,15S)-13-(5-aminopentyl)-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 11015270) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (10R,15S)-13-(5-aminopentyl)-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10R,15S)-13-(5-aminopentyl)-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 11015270 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (10R,15S)-13-(5-aminopentyl)-10-(3-hydroxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | NCCCCCN1C(=O)[C@@H]2Cc3c([nH]c4ccccc34)[C@@H](c3cccc(O)c3)N2C1=O |
| InChI | InChI=1S/C24H26N4O3/c25-11-4-1-5-12-27-23(30)20-14-18-17-9-2-3-10-19(17)26-21(18)22(28(20)24(27)31)15-7-6-8-16(29)13-15/h2-3,6-10,13,20,22,26,29H,1,4-5,11-12,14,25H2/t20-,22+/m0/s1 |
| InChIKey | MNECGJMZATXLBT-RBBKRZOGSA-N |
| XLogP | 3.28 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|