C24H31N5O2 — CID 110152769
2-[(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(3-acetamido-4-methylphenyl)acetamide (PubChem CID 110152769) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-[(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(3-acetamido-4-methylphenyl)acetamide.
| Compound Name | 2-[(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(3-acetamido-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 110152769 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-[(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-N-(3-acetamido-4-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(NC(=O)CN2C[C@H]3CCC[C@H](Cc4cnccn4)[C@H]3C2)ccc1C |
| InChI | InChI=1S/C24H31N5O2/c1-16-6-7-20(11-23(16)27-17(2)30)28-24(31)15-29-13-19-5-3-4-18(22(19)14-29)10-21-12-25-8-9-26-21/h6-9,11-12,18-19,22H,3-5,10,13-15H2,1-2H3,(H,27,30)(H,28,31)/t18-,19-,22-/m1/s1 |
| InChIKey | KQHWUMKSJFEKIC-WOIUINJBSA-N |
| XLogP | 3.27 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |