C24H42O2Si2 — CID 11015282
1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-dione (PubChem CID 11015282) has the molecular formula C24H42O2Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is 1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-dione.
| Compound Name | 1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-dione |
|---|---|
| PubChem CID | 11015282 |
| Molecular Formula | C24H42O2Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-dione |
| SMILES | CC(C)[Si](C#CC(=O)C(=O)C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42O2Si2/c1-17(2)27(18(3)4,19(5)6)15-13-23(25)24(26)14-16-28(20(7)8,21(9)10)22(11)12/h17-22H,1-12H3 |
| InChIKey | YAEZUESXYBUYSN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|