C20H29NO5 — CID 110152952
N-[(2R,4R,4aS,8aR)-2-(3-hydroxy-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide (PubChem CID 110152952) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[(2R,4R,4aS,8aR)-2-(3-hydroxy-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4R,4aS,8aR)-2-(3-hydroxy-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110152952 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[(2R,4R,4aS,8aR)-2-(3-hydroxy-4-methoxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@@H]1C[C@H](c2ccc(OC)c(O)c2)O[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C20H29NO5/c1-24-10-9-20(23)21-15-12-19(26-17-6-4-3-5-14(15)17)13-7-8-18(25-2)16(22)11-13/h7-8,11,14-15,17,19,22H,3-6,9-10,12H2,1-2H3,(H,21,23)/t14-,15+,17+,19+/m0/s1 |
| InChIKey | YIKCSDQSLXMMKX-BUIAKZPTSA-N |
| XLogP | 2.94 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |