C20H26F3NO3 — CID 110152954
N-[(2R,4R,4aS,8aR)-2-[4-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide (PubChem CID 110152954) has the molecular formula C20H26F3NO3 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-[(2R,4R,4aS,8aR)-2-[4-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4R,4aS,8aR)-2-[4-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110152954 |
| Molecular Formula | C20H26F3NO3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[(2R,4R,4aS,8aR)-2-[4-(trifluoromethyl)phenyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@@H]1C[C@H](c2ccc(C(F)(F)F)cc2)O[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C20H26F3NO3/c1-26-11-10-19(25)24-16-12-18(27-17-5-3-2-4-15(16)17)13-6-8-14(9-7-13)20(21,22)23/h6-9,15-18H,2-5,10-12H2,1H3,(H,24,25)/t15-,16+,17+,18+/m0/s1 |
| InChIKey | HAYPEEAKCMLYEV-BSDSXHPESA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |