C23H34N2O5 — CID 110153009
2-[4-[(2R,4R,4aS,7R,8aR)-4-acetamido-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]-2-ethoxyphenoxy]acetamide (PubChem CID 110153009) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is 2-[4-[(2R,4R,4aS,7R,8aR)-4-acetamido-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]-2-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(2R,4R,4aS,7R,8aR)-4-acetamido-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 110153009 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-[4-[(2R,4R,4aS,7R,8aR)-4-acetamido-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-2-yl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc([C@H]2C[C@@](C)(NC(C)=O)[C@@H]3CC[C@@H](C)C[C@H]3O2)ccc1OCC(N)=O |
| InChI | InChI=1S/C23H34N2O5/c1-5-28-20-11-16(7-9-18(20)29-13-22(24)27)21-12-23(4,25-15(3)26)17-8-6-14(2)10-19(17)30-21/h7,9,11,14,17,19,21H,5-6,8,10,12-13H2,1-4H3,(H2,24,27)(H,25,26)/t14-,17-,19-,21-,23-/m1/s1 |
| InChIKey | ZLMKXMOJZDAZJR-KOECYIFESA-N |
| XLogP | 3.11 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |