C21H29F2NO4 — CID 110153016
N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide (PubChem CID 110153016) has the molecular formula C21H29F2NO4 and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
|---|---|
| PubChem CID | 110153016 |
| Molecular Formula | C21H29F2NO4 |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]acetamide |
| SMILES | COc1cccc([C@H]2C[C@@](C)(NC(C)=O)[C@@H]3CC[C@@H](C)C[C@H]3O2)c1OC(F)F |
| InChI | InChI=1S/C21H29F2NO4/c1-12-8-9-15-17(10-12)27-18(11-21(15,3)24-13(2)25)14-6-5-7-16(26-4)19(14)28-20(22)23/h5-7,12,15,17-18,20H,8-11H2,1-4H3,(H,24,25)/t12-,15-,17-,18-,21-/m1/s1 |
| InChIKey | NZFMCUXCBQLRHV-UMGDAMFDSA-N |
| XLogP | 4.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |