C23H33F2NO4 — CID 110153017
N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide (PubChem CID 110153017) has the molecular formula C23H33F2NO4 and a molecular weight of 425.52 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110153017 |
| Molecular Formula | C23H33F2NO4 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-2-[2-(difluoromethoxy)-3-methoxyphenyl]-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
| SMILES | COc1cccc([C@H]2C[C@@](C)(NC(=O)C(C)C)[C@@H]3CC[C@@H](C)C[C@H]3O2)c1OC(F)F |
| InChI | InChI=1S/C23H33F2NO4/c1-13(2)21(27)26-23(4)12-19(29-18-11-14(3)9-10-16(18)23)15-7-6-8-17(28-5)20(15)30-22(24)25/h6-8,13-14,16,18-19,22H,9-12H2,1-5H3,(H,26,27)/t14-,16-,18-,19-,23-/m1/s1 |
| InChIKey | PBJNTXWTLAUVFB-QZOAIXELSA-N |
| XLogP | 5.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |