C24H33N3O2 — CID 110153021
N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-pyrazol-1-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide (PubChem CID 110153021) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-pyrazol-1-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide.
| Compound Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-pyrazol-1-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 110153021 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[(2R,4R,4aS,7R,8aR)-4,7-dimethyl-2-(4-pyrazol-1-ylphenyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@]1(C)C[C@H](c2ccc(-n3cccn3)cc2)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C24H33N3O2/c1-16(2)23(28)26-24(4)15-22(29-21-14-17(3)6-11-20(21)24)18-7-9-19(10-8-18)27-13-5-12-25-27/h5,7-10,12-13,16-17,20-22H,6,11,14-15H2,1-4H3,(H,26,28)/t17-,20-,21-,22-,24-/m1/s1 |
| InChIKey | OYFSECWNCRJAQP-PGDPNNLMSA-N |
| XLogP | 4.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |