C23H35NO3 — CID 110153053
N-[(2R,4S,4aS,7R,8aR)-2-(2,6-dimethylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide (PubChem CID 110153053) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-[(2R,4S,4aS,7R,8aR)-2-(2,6-dimethylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,4S,4aS,7R,8aR)-2-(2,6-dimethylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110153053 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | N-[(2R,4S,4aS,7R,8aR)-2-(2,6-dimethylphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromen-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)N[C@@]1(C)C[C@H](c2c(C)cccc2C)O[C@@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C23H35NO3/c1-15-9-10-18-19(13-15)27-20(22-16(2)7-6-8-17(22)3)14-23(18,4)24-21(25)11-12-26-5/h6-8,15,18-20H,9-14H2,1-5H3,(H,24,25)/t15-,18-,19-,20-,23+/m1/s1 |
| InChIKey | GBSHGFOIXAGMJF-FPXAXAJJSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |