C22H31NO2 — CID 110153175
N-[(5R,6S,8R,10S)-9,9-dimethyl-5-(2-phenylethyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide (PubChem CID 110153175) has the molecular formula C22H31NO2 and a molecular weight of 341.49 g/mol. Its IUPAC name is N-[(5R,6S,8R,10S)-9,9-dimethyl-5-(2-phenylethyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide.
| Compound Name | N-[(5R,6S,8R,10S)-9,9-dimethyl-5-(2-phenylethyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
|---|---|
| PubChem CID | 110153175 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | N-[(5R,6S,8R,10S)-9,9-dimethyl-5-(2-phenylethyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](CCc4ccccc4)OCCC31C2 |
| InChI | InChI=1S/C22H31NO2/c1-15(24)23-20-21(2,3)17-13-18-19(25-12-11-22(18,20)14-17)10-9-16-7-5-4-6-8-16/h4-8,17-20H,9-14H2,1-3H3,(H,23,24)/t17-,18-,19-,20+,22?/m1/s1 |
| InChIKey | OCQVHGWRGVFNCF-LBZTZSLCSA-N |
| XLogP | 3.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |