About [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate
[1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate (PubChem CID 11015376) has the molecular formula C19H16F7NO2
and a molecular weight of 423.33 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate.
Molecular Properties
| Compound Name | [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate |
| PubChem CID | 11015376 |
| Molecular Formula | C19H16F7NO2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate |
| SMILES | CC(=O)OC(CN(Cc1cccc(C(F)(F)F)c1)c1cccc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C19H16F7NO2/c1-12(28)29-17(19(24,25)26)11-27(16-7-3-6-15(20)9-16)10-13-4-2-5-14(8-13)18(21,22)23/h2-9,17H,10-11H2,1H3 |
| InChIKey | UZOXGZIPJWPNMB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate?
The IUPAC name of [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate (CID 11015376) is [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate.
What is the SMILES notation for [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate?
The canonical SMILES for [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate is CC(=O)OC(CN(Cc1cccc(C(F)(F)F)c1)c1cccc(F)c1)C(F)(F)F.
What is the InChIKey of [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate?
The InChIKey is UZOXGZIPJWPNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F7NO2/c1-12(28)29-17(19(24,25)26)11-27(16-7-3-6-15(20)9-16)10-13-4-2-5-14(8-13)18(21,22)23/h2-9,17H,10-11H2,1H3.
What are the key properties of [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate?
[1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate has a molecular weight of 423.33 g/mol, XLogP of 5.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1,1-trifluoro-3-[3-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-yl] acetate is sourced from PubChem (CID 11015376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).