C25H31N5O3 — CID 110153924
3-(3-aminopropoxy)-N-[[3-hydroxy-1-(1,6-naphthyridin-4-yl)piperidin-3-yl]methyl]-N-methylbenzamide (PubChem CID 110153924) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-N-[[3-hydroxy-1-(1,6-naphthyridin-4-yl)piperidin-3-yl]methyl]-N-methylbenzamide.
| Compound Name | 3-(3-aminopropoxy)-N-[[3-hydroxy-1-(1,6-naphthyridin-4-yl)piperidin-3-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110153924 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 3-(3-aminopropoxy)-N-[[3-hydroxy-1-(1,6-naphthyridin-4-yl)piperidin-3-yl]methyl]-N-methylbenzamide |
| SMILES | CN(CC1(O)CCCN(c2ccnc3ccncc23)C1)C(=O)c1cccc(OCCCN)c1 |
| InChI | InChI=1S/C25H31N5O3/c1-29(24(31)19-5-2-6-20(15-19)33-14-4-10-26)17-25(32)9-3-13-30(18-25)23-8-12-28-22-7-11-27-16-21(22)23/h2,5-8,11-12,15-16,32H,3-4,9-10,13-14,17-18,26H2,1H3 |
| InChIKey | SGEQCSVZXHGYFP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|