C19H25N3O4 — CID 110154034
1-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[[[(1S)-1-phenylethyl]amino]methyl]cyclopentyl]-5-methylpyrimidine-2,4-dione (PubChem CID 110154034) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[[[(1S)-1-phenylethyl]amino]methyl]cyclopentyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[[[(1S)-1-phenylethyl]amino]methyl]cyclopentyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110154034 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[(1R,2R,3R,4S)-2,3-dihydroxy-4-[[[(1S)-1-phenylethyl]amino]methyl]cyclopentyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2C[C@@H](CN[C@@H](C)c3ccccc3)[C@@H](O)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H25N3O4/c1-11-10-22(19(26)21-18(11)25)15-8-14(16(23)17(15)24)9-20-12(2)13-6-4-3-5-7-13/h3-7,10,12,14-17,20,23-24H,8-9H2,1-2H3,(H,21,25,26)/t12-,14-,15+,16+,17+/m0/s1 |
| InChIKey | KMTKPWFRGBTCLC-WSOGKROESA-N |
| XLogP | 0.48 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |