C19H22N8O5 — CID 110154058
N-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propyl]pyridine-2-carboxamide (PubChem CID 110154058) has the molecular formula C19H22N8O5 and a molecular weight of 442.44 g/mol. Its IUPAC name is N-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110154058 |
| Molecular Formula | C19H22N8O5 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[3-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolane-2-carbonyl]amino]propyl]pyridine-2-carboxamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)NCCCNC(=O)c2ccccn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H22N8O5/c20-15-11-16(25-8-24-15)27(9-26-11)19-13(29)12(28)14(32-19)18(31)23-7-3-6-22-17(30)10-4-1-2-5-21-10/h1-2,4-5,8-9,12-14,19,28-29H,3,6-7H2,(H,22,30)(H,23,31)(H2,20,24,25)/t12-,13+,14-,19+/m0/s1 |
| InChIKey | LILMNYQDQBNGCW-SSHHRWTQSA-N |
| XLogP | -1.64 |
| TPSA | 190.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|