C22H25F2NO3 — CID 110155044
N-[(2R,6S)-2,6-bis(4-fluorophenyl)-4-methyloxan-4-yl]-3-methoxypropanamide (PubChem CID 110155044) has the molecular formula C22H25F2NO3 and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[(2R,6S)-2,6-bis(4-fluorophenyl)-4-methyloxan-4-yl]-3-methoxypropanamide.
| Compound Name | N-[(2R,6S)-2,6-bis(4-fluorophenyl)-4-methyloxan-4-yl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110155044 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[(2R,6S)-2,6-bis(4-fluorophenyl)-4-methyloxan-4-yl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NC1(C)C[C@@H](c2ccc(F)cc2)O[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H25F2NO3/c1-22(25-21(26)11-12-27-2)13-19(15-3-7-17(23)8-4-15)28-20(14-22)16-5-9-18(24)10-6-16/h3-10,19-20H,11-14H2,1-2H3,(H,25,26)/t19-,20+,22? |
| InChIKey | RGFWUJSIFVOJGU-RLAPIPATSA-N |
| XLogP | 4.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |