C21H23Cl2NO2 — CID 110155144
N-[(2S,6R)-2,6-bis(3-chlorophenyl)-4-methyloxan-4-yl]propanamide (PubChem CID 110155144) has the molecular formula C21H23Cl2NO2 and a molecular weight of 392.33 g/mol. Its IUPAC name is N-[(2S,6R)-2,6-bis(3-chlorophenyl)-4-methyloxan-4-yl]propanamide.
| Compound Name | N-[(2S,6R)-2,6-bis(3-chlorophenyl)-4-methyloxan-4-yl]propanamide |
|---|---|
| PubChem CID | 110155144 |
| Molecular Formula | C21H23Cl2NO2 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-[(2S,6R)-2,6-bis(3-chlorophenyl)-4-methyloxan-4-yl]propanamide |
| SMILES | CCC(=O)NC1(C)C[C@@H](c2cccc(Cl)c2)O[C@@H](c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H23Cl2NO2/c1-3-20(25)24-21(2)12-18(14-6-4-8-16(22)10-14)26-19(13-21)15-7-5-9-17(23)11-15/h4-11,18-19H,3,12-13H2,1-2H3,(H,24,25)/t18-,19+,21? |
| InChIKey | DCGDWULHKOCRFA-PMSBKCLSSA-N |
| XLogP | 5.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |