C25H26FN3O4 — CID 110155539
N-[(1R,2S,3R,4R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(3-fluorophenoxy)-3-hydroxycyclopentyl]-2-methyl-1,3-oxazole-4-carboxamide (PubChem CID 110155539) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(3-fluorophenoxy)-3-hydroxycyclopentyl]-2-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1R,2S,3R,4R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(3-fluorophenoxy)-3-hydroxycyclopentyl]-2-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110155539 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[(1R,2S,3R,4R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-(3-fluorophenoxy)-3-hydroxycyclopentyl]-2-methyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)N[C@@H]2C[C@@H](Oc3cccc(F)c3)[C@H](O)[C@H]2N2CCc3ccccc3C2)co1 |
| InChI | InChI=1S/C25H26FN3O4/c1-15-27-21(14-32-15)25(31)28-20-12-22(33-19-8-4-7-18(26)11-19)24(30)23(20)29-10-9-16-5-2-3-6-17(16)13-29/h2-8,11,14,20,22-24,30H,9-10,12-13H2,1H3,(H,28,31)/t20-,22-,23+,24+/m1/s1 |
| InChIKey | VFLSRIUZKYAMMS-AZOUXBGGSA-N |
| XLogP | 2.86 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |