C26H37FO4 — CID 11015558
(1'R,5'S,6'R,9'S,10'S,13'R)-6'-fluoro-6'-(1-methoxyethenyl)-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene] (PubChem CID 11015558) has the molecular formula C26H37FO4 and a molecular weight of 432.58 g/mol. Its IUPAC name is (1'R,5'S,6'R,9'S,10'S,13'R)-6'-fluoro-6'-(1-methoxyethenyl)-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene].
| Compound Name | (1'R,5'S,6'R,9'S,10'S,13'R)-6'-fluoro-6'-(1-methoxyethenyl)-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene] |
|---|---|
| PubChem CID | 11015558 |
| Molecular Formula | C26H37FO4 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (1'R,5'S,6'R,9'S,10'S,13'R)-6'-fluoro-6'-(1-methoxyethenyl)-5,5,5'-trimethylspiro[1,3-dioxane-2,15'-18-oxapentacyclo[11.4.1.01,13.02,10.05,9]octadec-2-ene] |
| SMILES | C=C(OC)[C@@]1(F)CC[C@H]2[C@@H]3CC[C@@]45CC6(CC[C@@]4(O5)C3=CC[C@@]21C)OCC(C)(C)CO6 |
| InChI | InChI=1S/C26H37FO4/c1-17(28-5)25(27)11-8-19-18-6-10-23-14-24(29-15-21(2,3)16-30-24)12-13-26(23,31-23)20(18)7-9-22(19,25)4/h7,18-19H,1,6,8-16H2,2-5H3/t18-,19-,22-,23+,25-,26+/m0/s1 |
| InChIKey | LRKBSFAUZAWEAT-USCKFWDHSA-N |
| XLogP | 5.47 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|