C23H32O2S2Si — CID 11015561
(1S)-1-phenyl-2-[2-[(2S)-2-phenyl-2-trimethylsilyloxyethyl]-1,3-dithian-2-yl]ethanol (PubChem CID 11015561) has the molecular formula C23H32O2S2Si and a molecular weight of 432.73 g/mol. Its IUPAC name is (1S)-1-phenyl-2-[2-[(2S)-2-phenyl-2-trimethylsilyloxyethyl]-1,3-dithian-2-yl]ethanol.
| Compound Name | (1S)-1-phenyl-2-[2-[(2S)-2-phenyl-2-trimethylsilyloxyethyl]-1,3-dithian-2-yl]ethanol |
|---|---|
| PubChem CID | 11015561 |
| Molecular Formula | C23H32O2S2Si |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (1S)-1-phenyl-2-[2-[(2S)-2-phenyl-2-trimethylsilyloxyethyl]-1,3-dithian-2-yl]ethanol |
| SMILES | C[Si](C)(C)O[C@@H](CC1(C[C@H](O)c2ccccc2)SCCCS1)c1ccccc1 |
| InChI | InChI=1S/C23H32O2S2Si/c1-28(2,3)25-22(20-13-8-5-9-14-20)18-23(26-15-10-16-27-23)17-21(24)19-11-6-4-7-12-19/h4-9,11-14,21-22,24H,10,15-18H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | ONMYIPNGPAQBQB-VXKWHMMOSA-N |
| XLogP | 6.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|