About [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone
[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone (PubChem CID 110155802) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone |
| PubChem CID | 110155802 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1ccon1)N1CC[C@@]2(CCCO2)[C@@H](O)C1 |
| InChI | InChI=1S/C12H16N2O4/c15-10-8-14(11(16)9-2-7-18-13-9)5-4-12(10)3-1-6-17-12/h2,7,10,15H,1,3-6,8H2/t10-,12-/m0/s1 |
| InChIKey | RGXLGUSXPQFRQM-JQWIXIFHSA-N |
| XLogP | 0.43 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone?
The IUPAC name of [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone (CID 110155802) is [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone.
What is the SMILES notation for [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone?
The canonical SMILES for [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone is O=C(c1ccon1)N1CC[C@@]2(CCCO2)[C@@H](O)C1.
What is the InChIKey of [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone?
The InChIKey is RGXLGUSXPQFRQM-JQWIXIFHSA-N. The full InChI is InChI=1S/C12H16N2O4/c15-10-8-14(11(16)9-2-7-18-13-9)5-4-12(10)3-1-6-17-12/h2,7,10,15H,1,3-6,8H2/t10-,12-/m0/s1.
What are the key properties of [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone?
[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone has a molecular weight of 252.27 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-(1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 110155802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).