About 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid
4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid (PubChem CID 110155869) has the molecular formula C12H19NO5
and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid |
| PubChem CID | 110155869 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1CC[C@@]2(CCCO2)[C@@H](O)C1 |
| InChI | InChI=1S/C12H19NO5/c14-9-8-13(10(15)2-3-11(16)17)6-5-12(9)4-1-7-18-12/h9,14H,1-8H2,(H,16,17)/t9-,12-/m0/s1 |
| InChIKey | NFILAZKLOOOASN-CABZTGNLSA-N |
| XLogP | -0.01 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid?
The IUPAC name of 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid (CID 110155869) is 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid?
The canonical SMILES for 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid is O=C(O)CCC(=O)N1CC[C@@]2(CCCO2)[C@@H](O)C1.
What is the InChIKey of 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid?
The InChIKey is NFILAZKLOOOASN-CABZTGNLSA-N. The full InChI is InChI=1S/C12H19NO5/c14-9-8-13(10(15)2-3-11(16)17)6-5-12(9)4-1-7-18-12/h9,14H,1-8H2,(H,16,17)/t9-,12-/m0/s1.
What are the key properties of 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid?
4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid has a molecular weight of 257.29 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5S,6S)-6-hydroxy-1-oxa-8-azaspiro[4.5]decan-8-yl]-4-oxobutanoic acid is sourced from PubChem (CID 110155869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).