About 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one
3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one (PubChem CID 110156205) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one |
| PubChem CID | 110156205 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc[nH]c1=O)N1C[C@H](OCc2ccccc2)[C@]2(CCCO2)C1 |
| InChI | InChI=1S/C20H22N2O4/c23-18-16(8-4-10-21-18)19(24)22-12-17(20(14-22)9-5-11-26-20)25-13-15-6-2-1-3-7-15/h1-4,6-8,10,17H,5,9,11-14H2,(H,21,23)/t17-,20-/m0/s1 |
| InChIKey | BWMIZSLFAWGZHA-PXNSSMCTSA-N |
| XLogP | 1.97 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one?
The IUPAC name of 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one (CID 110156205) is 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one.
What is the SMILES notation for 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one?
The canonical SMILES for 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one is O=C(c1ccc[nH]c1=O)N1C[C@H](OCc2ccccc2)[C@]2(CCCO2)C1.
What is the InChIKey of 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one?
The InChIKey is BWMIZSLFAWGZHA-PXNSSMCTSA-N. The full InChI is InChI=1S/C20H22N2O4/c23-18-16(8-4-10-21-18)19(24)22-12-17(20(14-22)9-5-11-26-20)25-13-15-6-2-1-3-7-15/h1-4,6-8,10,17H,5,9,11-14H2,(H,21,23)/t17-,20-/m0/s1.
What are the key properties of 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one?
3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one has a molecular weight of 354.41 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5S,9S)-9-phenylmethoxy-1-oxa-7-azaspiro[4.4]nonane-7-carbonyl]-1H-pyridin-2-one is sourced from PubChem (CID 110156205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).