About (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane
(5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane (PubChem CID 110156319) has the molecular formula C16H21F2NO2
and a molecular weight of 297.34 g/mol. Its IUPAC name is (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane |
| PubChem CID | 110156319 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane |
| SMILES | CO[C@H]1CN(Cc2cc(F)ccc2F)CC[C@@]12CCCO2 |
| InChI | InChI=1S/C16H21F2NO2/c1-20-15-11-19(7-6-16(15)5-2-8-21-16)10-12-9-13(17)3-4-14(12)18/h3-4,9,15H,2,5-8,10-11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ZHCDBPMRSIIDPB-HOTGVXAUSA-N |
| XLogP | 2.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane?
The IUPAC name of (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane (CID 110156319) is (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane.
What is the SMILES notation for (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane?
The canonical SMILES for (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane is CO[C@H]1CN(Cc2cc(F)ccc2F)CC[C@@]12CCCO2.
What is the InChIKey of (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane?
The InChIKey is ZHCDBPMRSIIDPB-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H21F2NO2/c1-20-15-11-19(7-6-16(15)5-2-8-21-16)10-12-9-13(17)3-4-14(12)18/h3-4,9,15H,2,5-8,10-11H2,1H3/t15-,16-/m0/s1.
What are the key properties of (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane?
(5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane has a molecular weight of 297.34 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6S)-8-[(2,5-difluorophenyl)methyl]-6-methoxy-1-oxa-8-azaspiro[4.5]decane is sourced from PubChem (CID 110156319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).