C19H25FN2O3 — CID 110156400
1-[(2R,3aS,7aS)-1-acetyl-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 110156400) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-1-acetyl-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-1-acetyl-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110156400 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[(2R,3aS,7aS)-1-acetyl-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | CC(=O)N1[C@H]2CCN(C(=O)Cc3ccc(F)cc3)C[C@@H]2C[C@]1(C)CO |
| InChI | InChI=1S/C19H25FN2O3/c1-13(24)22-17-7-8-21(11-15(17)10-19(22,2)12-23)18(25)9-14-3-5-16(20)6-4-14/h3-6,15,17,23H,7-12H2,1-2H3/t15-,17-,19+/m0/s1 |
| InChIKey | ABJVQFJNHSJFPC-VDZJLULYSA-N |
| XLogP | 1.59 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |