About 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one
1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one (PubChem CID 110156411) has the molecular formula C16H25N3O3
and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one |
| PubChem CID | 110156411 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one |
| SMILES | CO[C@H]1CCN(C(=O)CCn2ccc(C)n2)C[C@@]12CCCO2 |
| InChI | InChI=1S/C16H25N3O3/c1-13-4-9-19(17-13)10-6-15(20)18-8-5-14(21-2)16(12-18)7-3-11-22-16/h4,9,14H,3,5-8,10-12H2,1-2H3/t14-,16-/m0/s1 |
| InChIKey | SDMXEZLBBIDVSE-HOCLYGCPSA-N |
| XLogP | 1.38 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one?
The IUPAC name of 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one (CID 110156411) is 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one.
What is the SMILES notation for 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one?
The canonical SMILES for 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one is CO[C@H]1CCN(C(=O)CCn2ccc(C)n2)C[C@@]12CCCO2.
What is the InChIKey of 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one?
The InChIKey is SDMXEZLBBIDVSE-HOCLYGCPSA-N. The full InChI is InChI=1S/C16H25N3O3/c1-13-4-9-19(17-13)10-6-15(20)18-8-5-14(21-2)16(12-18)7-3-11-22-16/h4,9,14H,3,5-8,10-12H2,1-2H3/t14-,16-/m0/s1.
What are the key properties of 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one?
1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one has a molecular weight of 307.39 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5S,6S)-6-methoxy-1-oxa-9-azaspiro[4.5]decan-9-yl]-3-(3-methylpyrazol-1-yl)propan-1-one is sourced from PubChem (CID 110156411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).