C18H28F2N2O3 — CID 110156576
1-[(2R,3aS,7aS)-1-(4,4-difluorocyclohexanecarbonyl)-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]ethanone (PubChem CID 110156576) has the molecular formula C18H28F2N2O3 and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-1-(4,4-difluorocyclohexanecarbonyl)-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-1-(4,4-difluorocyclohexanecarbonyl)-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 110156576 |
| Molecular Formula | C18H28F2N2O3 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[(2R,3aS,7aS)-1-(4,4-difluorocyclohexanecarbonyl)-2-(hydroxymethyl)-2-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-5-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2[C@H](C1)C[C@](C)(CO)N2C(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H28F2N2O3/c1-12(24)21-8-5-15-14(10-21)9-17(2,11-23)22(15)16(25)13-3-6-18(19,20)7-4-13/h13-15,23H,3-11H2,1-2H3/t14-,15-,17+/m0/s1 |
| InChIKey | BLNCGXPIACMNAY-YQQAZPJKSA-N |
| XLogP | 2.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |