C25H40O7 — CID 11015858
[(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-15-hydroxy-14-methoxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate (PubChem CID 11015858) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-15-hydroxy-14-methoxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate.
| Compound Name | [(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-15-hydroxy-14-methoxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate |
|---|---|
| PubChem CID | 11015858 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | [(1S,2S,3R,4R,7R,8R,11S,14R,15R,17S)-15-hydroxy-14-methoxy-4,8,11,15-tetramethyl-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C)CC[C@@H]2[C@H]3[C@@H]1[C@@H]1C[C@@](C)(O)[C@H](OC)CC[C@](C)(OC(=O)[C@@H]2C)[C@H]3O1 |
| InChI | InChI=1S/C25H40O7/c1-7-8-18(26)31-24(4)11-9-15-14(2)22(27)32-25(5)12-10-17(29-6)23(3,28)13-16-20(24)19(15)21(25)30-16/h14-17,19-21,28H,7-13H2,1-6H3/t14-,15+,16+,17-,19+,20+,21+,23-,24-,25+/m1/s1 |
| InChIKey | IPJWOGNRRLDDDL-QMPJCHAXSA-N |
| XLogP | 3.40 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |