C23H38O7Si — CID 11015889
[(2R,3S)-2-[(2S,6R)-6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]hept-6-en-3-yl] acetate (PubChem CID 11015889) has the molecular formula C23H38O7Si and a molecular weight of 454.64 g/mol. Its IUPAC name is [(2R,3S)-2-[(2S,6R)-6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]hept-6-en-3-yl] acetate.
| Compound Name | [(2R,3S)-2-[(2S,6R)-6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]hept-6-en-3-yl] acetate |
|---|---|
| PubChem CID | 11015889 |
| Molecular Formula | C23H38O7Si |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [(2R,3S)-2-[(2S,6R)-6-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-oxopyran-2-yl]hept-6-en-3-yl] acetate |
| SMILES | C=CCC[C@H](OC(C)=O)[C@@H](C)[C@@H]1O[C@@](CO[Si](C)(C)C(C)(C)C)(OC(C)=O)C=CC1=O |
| InChI | InChI=1S/C23H38O7Si/c1-10-11-12-20(28-17(3)24)16(2)21-19(26)13-14-23(30-21,29-18(4)25)15-27-31(8,9)22(5,6)7/h10,13-14,16,20-21H,1,11-12,15H2,2-9H3/t16-,20+,21+,23+/m1/s1 |
| InChIKey | WSOMFEYQCXRXLF-UXYIHQQYSA-N |
| XLogP | 4.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|