C27H36N2O3 — CID 110160287
(4aS,9aS)-7-[(5-tert-butyl-2-phenylmethoxyphenyl)methyl]-4-methyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one (PubChem CID 110160287) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is (4aS,9aS)-7-[(5-tert-butyl-2-phenylmethoxyphenyl)methyl]-4-methyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one.
| Compound Name | (4aS,9aS)-7-[(5-tert-butyl-2-phenylmethoxyphenyl)methyl]-4-methyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
|---|---|
| PubChem CID | 110160287 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (4aS,9aS)-7-[(5-tert-butyl-2-phenylmethoxyphenyl)methyl]-4-methyl-4a,5,6,8,9,9a-hexahydro-[1,4]oxazino[2,3-d]azepin-3-one |
| SMILES | CN1C(=O)CO[C@H]2CCN(Cc3cc(C(C)(C)C)ccc3OCc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C27H36N2O3/c1-27(2,3)22-10-11-24(31-18-20-8-6-5-7-9-20)21(16-22)17-29-14-12-23-25(13-15-29)32-19-26(30)28(23)4/h5-11,16,23,25H,12-15,17-19H2,1-4H3/t23-,25-/m0/s1 |
| InChIKey | ZHQMLHNGHDTXPL-ZCYQVOJMSA-N |
| XLogP | 4.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |