About 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane
2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane (PubChem CID 110160688) has the molecular formula C17H26N2O2S
and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane |
| PubChem CID | 110160688 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane |
| SMILES | CC1(C)CCC2(CCNCC2)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26N2O2S/c1-16(2)8-9-17(10-12-18-13-11-17)14-19(16)22(20,21)15-6-4-3-5-7-15/h3-7,18H,8-14H2,1-2H3 |
| InChIKey | CQJVINITGSUXFJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane?
The IUPAC name of 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane (CID 110160688) is 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane?
The canonical SMILES for 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane is CC1(C)CCC2(CCNCC2)CN1S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane?
The InChIKey is CQJVINITGSUXFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2S/c1-16(2)8-9-17(10-12-18-13-11-17)14-19(16)22(20,21)15-6-4-3-5-7-15/h3-7,18H,8-14H2,1-2H3.
What are the key properties of 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane?
2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane has a molecular weight of 322.47 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-3,3-dimethyl-2,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 110160688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).