About CID 11016087
CID 11016087 (PubChem CID 11016087) has the molecular formula C25H17N2
and a molecular weight of 345.43 g/mol.
Molecular Properties
| Compound Name | CID 11016087 |
| PubChem CID | 11016087 |
| Molecular Formula | C25H17N2 |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | — |
| SMILES | N#CC(C#N)=Cc1ccc(/C=C/c2ccc(/C=C/[C]3[CH][CH][CH][CH]3)cc2)cc1 |
| InChI | InChI=1S/C25H17N2/c26-18-25(19-27)17-24-15-13-23(14-16-24)12-11-22-9-7-21(8-10-22)6-5-20-3-1-2-4-20/h1-17H/b6-5+,12-11+ |
| InChIKey | QQMBNWIARWLYEC-HDZHTHRUSA-N |
| XLogP | 5.71 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 11016087 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11016087?
The IUPAC name of CID 11016087 (CID 11016087) is not available.
What is the SMILES notation for CID 11016087?
The canonical SMILES for CID 11016087 is N#CC(C#N)=Cc1ccc(/C=C/c2ccc(/C=C/[C]3[CH][CH][CH][CH]3)cc2)cc1.
What is the InChIKey of CID 11016087?
The InChIKey is QQMBNWIARWLYEC-HDZHTHRUSA-N. The full InChI is InChI=1S/C25H17N2/c26-18-25(19-27)17-24-15-13-23(14-16-24)12-11-22-9-7-21(8-10-22)6-5-20-3-1-2-4-20/h1-17H/b6-5+,12-11+.
What are the key properties of CID 11016087?
CID 11016087 has a molecular weight of 345.43 g/mol, XLogP of 5.71, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11016087 is sourced from PubChem (CID 11016087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).