C29H34FNO5 — CID 110161113
3-[(3R,4aR,5R,10bR)-1'-[3-(3-fluorophenyl)propanoyl]-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid (PubChem CID 110161113) has the molecular formula C29H34FNO5 and a molecular weight of 495.59 g/mol. Its IUPAC name is 3-[(3R,4aR,5R,10bR)-1'-[3-(3-fluorophenyl)propanoyl]-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid.
| Compound Name | 3-[(3R,4aR,5R,10bR)-1'-[3-(3-fluorophenyl)propanoyl]-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid |
|---|---|
| PubChem CID | 110161113 |
| Molecular Formula | C29H34FNO5 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 3-[(3R,4aR,5R,10bR)-1'-[3-(3-fluorophenyl)propanoyl]-5-methylspiro[2,4,4a,10b-tetrahydropyrano[3,2-c]chromene-3,3'-piperidine]-5-yl]propanoic acid |
| SMILES | C[C@]1(CCC(=O)O)Oc2ccccc2[C@@H]2OC[C@]3(CCCN(C(=O)CCc4cccc(F)c4)C3)C[C@H]21 |
| InChI | InChI=1S/C29H34FNO5/c1-28(14-12-26(33)34)23-17-29(19-35-27(23)22-8-2-3-9-24(22)36-28)13-5-15-31(18-29)25(32)11-10-20-6-4-7-21(30)16-20/h2-4,6-9,16,23,27H,5,10-15,17-19H2,1H3,(H,33,34)/t23-,27+,28-,29-/m1/s1 |
| InChIKey | LUSCGTZNMZPSKO-GSDPDGKRSA-N |
| XLogP | 5.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |